Products 956003-87-5

CAS 956003-87-5 appears in our catalog under these names: 3,5-Difluoropyridine-4-boronic acid, 96%, (3,5–DIFLUOROPYRIDIN–4–YL)BORONIC ACID. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

(3,5-difluoro-4-pyridinyl)boronic acid (CAS 956003-87-5) is a chemical compound with the molecular formula C5H4BF2NO2 and a molecular weight of 158.90 g/mol. IUPAC name: (3,5-difluoro-4-pyridinyl)boronic acid. InChIKey: AJCALFSHGHOQLL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BF2NO2
Molecular weight158.90 g/mol
IUPAC name(3,5-difluoro-4-pyridinyl)boronic acid
InChIKeyAJCALFSHGHOQLL-UHFFFAOYSA-N
SMILESB(C1=C(C=NC=C1F)F)(O)O

Computed by PubChem (NCBI)