Products 872041-95-7

CAS 872041-95-7 appears in our catalog under these names: 2,5-Difluoropyridinr-3-boronic acid, 95%, (2,5–DIFLUOROPYRIDIN–3–YL)BORONIC ACID, (2,5-Difluoropyridin-3-yl)boronic acid 98%, 2,5-Difluoropyridinr-3-boronic acid, 98%, 98%, (2,5-Difluoropyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

(2,5-difluoro-3-pyridinyl)boronic acid (CAS 872041-95-7) is a chemical compound with the molecular formula C5H4BF2NO2 and a molecular weight of 158.90 g/mol. IUPAC name: (2,5-difluoro-3-pyridinyl)boronic acid. InChIKey: FJBXMHAWGCNDTB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BF2NO2
Molecular weight158.90 g/mol
IUPAC name(2,5-difluoro-3-pyridinyl)boronic acid
InChIKeyFJBXMHAWGCNDTB-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1F)F)(O)O

Computed by PubChem (NCBI)