Products 1263377-27-0
CAS 1263377-27-0 is the registry number for 2-Ethynyl-1-fluoro-4-(trifluoromethyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-ethynyl-1-fluoro-4-(trifluoromethyl)benzene (CAS 1263377-27-0) is a chemical compound with the molecular formula C9H4F4 and a molecular weight of 188.12 g/mol. IUPAC name: 2-ethynyl-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: FPXHQMWSRWFGDP-UHFFFAOYSA-N.
| Molecular formula | C9H4F4 |
|---|---|
| Molecular weight | 188.12 g/mol |
| IUPAC name | 2-ethynyl-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | FPXHQMWSRWFGDP-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=CC(=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)