Products 1823362-73-7
CAS 1823362-73-7 is the registry number for 1-Ethynyl-2-fluoro-3-(trifluoromethyl)benzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-ethynyl-2-fluoro-3-(trifluoromethyl)benzene (CAS 1823362-73-7) is a chemical compound with the molecular formula C9H4F4 and a molecular weight of 188.12 g/mol. IUPAC name: 1-ethynyl-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: MMSIZIFBLDTZID-UHFFFAOYSA-N.
| Molecular formula | C9H4F4 |
|---|---|
| Molecular weight | 188.12 g/mol |
| IUPAC name | 1-ethynyl-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | MMSIZIFBLDTZID-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C(=CC=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)