CAS 2241742-65-2 is the registry number for 1-(Difluoromethyl)-2-ethynyl-4,5-difluorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(difluoromethyl)-2-ethynyl-4,5-difluorobenzene (CAS 2241742-65-2) is a chemical compound with the molecular formula C9H4F4 and a molecular weight of 188.12 g/mol. IUPAC name: 1-(difluoromethyl)-2-ethynyl-4,5-difluorobenzene. InChIKey: BNGRIVLREGOPGE-UHFFFAOYSA-N.
| Molecular formula | C9H4F4 |
|---|---|
| Molecular weight | 188.12 g/mol |
| IUPAC name | 1-(difluoromethyl)-2-ethynyl-4,5-difluorobenzene |
| InChIKey | BNGRIVLREGOPGE-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1C(F)F)F)F |
Computed by PubChem (NCBI)