CAS 1263404-74-5 is the registry number for 2-Amino-4-((4-fluorobenzyl)amino)-1-nitrobenzene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10g, 1g.
1-N-[(4-fluorophenyl)methyl]-4-nitrobenzene-1,3-diamine (CAS 1263404-74-5) is a chemical compound with the molecular formula C13H12FN3O2 and a molecular weight of 261.25 g/mol. IUPAC name: 1-N-[(4-fluorophenyl)methyl]-4-nitrobenzene-1,3-diamine. InChIKey: BGRAXSCMDDBKRP-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O2 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 1-N-[(4-fluorophenyl)methyl]-4-nitrobenzene-1,3-diamine |
| InChIKey | BGRAXSCMDDBKRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=CC(=C(C=C2)[N+](=O)[O-])N)F |
Computed by PubChem (NCBI)