CAS 852146-73-7 appears in our catalog under these names: KR-32568, 97%, KR-32568/ 99.89% (existing batch purity), KR–32568, KR-32568 99%, N-Carbamimidoyl-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide, GR, GR. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide (CAS 852146-73-7) is a chemical compound with the molecular formula C13H12FN3O2 and a molecular weight of 261.25 g/mol. IUPAC name: N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide. InChIKey: DTLDHYBZLVASJQ-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O2 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide |
| InChIKey | DTLDHYBZLVASJQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C2=CC=C(O2)C(=O)N=C(N)N |
Computed by PubChem (NCBI)