CAS 782441-07-0 is the registry number for 4-(4-Fluorophenyl)-3H,4H,5H,6H,7H-imidazo(4,5-c)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid (CAS 782441-07-0) is a chemical compound with the molecular formula C13H12FN3O2 and a molecular weight of 261.25 g/mol. IUPAC name: 4-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid. InChIKey: VUXDARVRKCNAKL-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O2 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| InChIKey | VUXDARVRKCNAKL-UHFFFAOYSA-N |
| SMILES | C1C(NC(C2=C1NC=N2)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)