CAS 126400-94-0 is the registry number for N-Benzoyl-N-benzyl-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-2-benzamidopropanoate (CAS 126400-94-0) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: benzyl (2S)-2-benzamidopropanoate. InChIKey: FMTNHGGUNJJIKA-ZDUSSCGKSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | benzyl (2S)-2-benzamidopropanoate |
| InChIKey | FMTNHGGUNJJIKA-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)