Products 1264127-92-5

CAS 1264127-92-5 appears in our catalog under these names: (5-Fluoro-2-isopropoxypyridin-4-yl)boronic acid, 95%, (5-Fluoro-2-isopropoxypyridin-4-yl)boronic acid 95%, (5-Fluoro-2-isopropoxypyridin-4-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(5-fluoro-2-propan-2-yloxy-4-pyridinyl)boronic acid (CAS 1264127-92-5) is a chemical compound with the molecular formula C8H11BFNO3 and a molecular weight of 198.99 g/mol. IUPAC name: (5-fluoro-2-propan-2-yloxy-4-pyridinyl)boronic acid. InChIKey: IEMIVKVJKMZTOE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BFNO3
Molecular weight198.99 g/mol
IUPAC name(5-fluoro-2-propan-2-yloxy-4-pyridinyl)boronic acid
InChIKeyIEMIVKVJKMZTOE-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1F)OC(C)C)(O)O

Computed by PubChem (NCBI)