CAS 2225171-59-3 is the registry number for 4–Fluoro–2–(iso–propoxy)pyridine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(4-fluoro-6-propan-2-yloxy-3-pyridinyl)boronic acid (CAS 2225171-59-3) is a chemical compound with the molecular formula C8H11BFNO3 and a molecular weight of 198.99 g/mol. IUPAC name: (4-fluoro-6-propan-2-yloxy-3-pyridinyl)boronic acid. InChIKey: HDGDNOOMDCMRBM-UHFFFAOYSA-N.
| Molecular formula | C8H11BFNO3 |
|---|---|
| Molecular weight | 198.99 g/mol |
| IUPAC name | (4-fluoro-6-propan-2-yloxy-3-pyridinyl)boronic acid |
| InChIKey | HDGDNOOMDCMRBM-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1F)OC(C)C)(O)O |
Computed by PubChem (NCBI)