CAS 1451391-01-7 appears in our catalog under these names: 2-Fluoro-5-isopropoxypyridine-3-boronic acid, 95%, (2-Fluoro-5-isopropoxypyridin-3-yl)boronic acid, ≥95%, ≥95%, 2-Fluoro-5-isopropoxypyridine-3-boronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2-fluoro-5-propan-2-yloxy-3-pyridinyl)boronic acid (CAS 1451391-01-7) is a chemical compound with the molecular formula C8H11BFNO3 and a molecular weight of 198.99 g/mol. IUPAC name: (2-fluoro-5-propan-2-yloxy-3-pyridinyl)boronic acid. InChIKey: RFZYRXLTARRVRZ-UHFFFAOYSA-N.
| Molecular formula | C8H11BFNO3 |
|---|---|
| Molecular weight | 198.99 g/mol |
| IUPAC name | (2-fluoro-5-propan-2-yloxy-3-pyridinyl)boronic acid |
| InChIKey | RFZYRXLTARRVRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1F)OC(C)C)(O)O |
Computed by PubChem (NCBI)