CAS 1264513-41-8 is the registry number for (6–(thiophen–3–yl)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(6-thiophen-3-yl-3-pyridinyl)boronic acid (CAS 1264513-41-8) is a chemical compound with the molecular formula C9H8BNO2S and a molecular weight of 205.05 g/mol. IUPAC name: (6-thiophen-3-yl-3-pyridinyl)boronic acid. InChIKey: CBRAUGRNNCKVHC-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2S |
|---|---|
| Molecular weight | 205.05 g/mol |
| IUPAC name | (6-thiophen-3-yl-3-pyridinyl)boronic acid |
| InChIKey | CBRAUGRNNCKVHC-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C2=CSC=C2)(O)O |
Computed by PubChem (NCBI)