CAS 1316856-96-8 appears in our catalog under these names: 3-(1,3-Thiazol-2-yl)phenylboronic acid, 98%, (3-(Thiazol-2-yl)phenyl)boronic acid 98%, 3-(1,3-Thiazol-2-yl)phenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
[3-(1,3-thiazol-2-yl)phenyl]boronic acid (CAS 1316856-96-8) is a chemical compound with the molecular formula C9H8BNO2S and a molecular weight of 205.05 g/mol. IUPAC name: [3-(1,3-thiazol-2-yl)phenyl]boronic acid. InChIKey: LBBXUVJDDULYRR-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2S |
|---|---|
| Molecular weight | 205.05 g/mol |
| IUPAC name | [3-(1,3-thiazol-2-yl)phenyl]boronic acid |
| InChIKey | LBBXUVJDDULYRR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NC=CS2)(O)O |
Computed by PubChem (NCBI)