CAS 2225176-80-5 is the registry number for 5–(Pyridin–4–yl)thiophene–2–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(5-pyridin-4-ylthiophen-2-yl)boronic acid (CAS 2225176-80-5) is a chemical compound with the molecular formula C9H8BNO2S and a molecular weight of 205.05 g/mol. IUPAC name: (5-pyridin-4-ylthiophen-2-yl)boronic acid. InChIKey: AJACTOJMBSUHOP-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2S |
|---|---|
| Molecular weight | 205.05 g/mol |
| IUPAC name | (5-pyridin-4-ylthiophen-2-yl)boronic acid |
| InChIKey | AJACTOJMBSUHOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)