CAS 1265295-20-2 appears in our catalog under these names: (4-((5,6-Diphenyl-2-pyrazinyl)(isopropyl-d7)amino)butoxy)acetic Acid, 99 atom % D, min 98% Chemical Purity, Selexipag Active Metabolite-d7, MRE–269–d7, MRE-269-d7, 99%, 99%, MRE-269-d7, 99.59%. Offered by: CDN, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5 mg, 1 mg.
2-[4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)amino]butoxy]acetic acid (CAS 1265295-20-2) is a chemical compound with the molecular formula C25H29N3O3 and a molecular weight of 426.6 g/mol. IUPAC name: 2-[4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)amino]butoxy]acetic acid. InChIKey: OJQMKCBWYCWFPU-HXAWLNHQSA-N.
| Molecular formula | C25H29N3O3 |
|---|---|
| Molecular weight | 426.6 g/mol |
| IUPAC name | 2-[4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)amino]butoxy]acetic acid |
| InChIKey | OJQMKCBWYCWFPU-HXAWLNHQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N(CCCCOCC(=O)O)C1=CN=C(C(=N1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)