Products 2600795-07-9

CAS 2600795-07-9 is the registry number for M4K-2009, 99.35%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 50 mg, 1 mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

1-[4-[4-methyl-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine (CAS 2600795-07-9) is a chemical compound with the molecular formula C25H29N3O3 and a molecular weight of 419.5 g/mol. IUPAC name: 1-[4-[4-methyl-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine. InChIKey: RKBYYWVZFBATHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC25H29N3O3
Molecular weight419.5 g/mol
IUPAC name1-[4-[4-methyl-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenyl]piperazine
InChIKeyRKBYYWVZFBATHQ-UHFFFAOYSA-N
SMILESCC1=C(C=NC=C1C2=CC=C(C=C2)N3CCNCC3)C4=CC(=C(C(=C4)OC)OC)OC

Computed by PubChem (NCBI)