Products 1265295-56-4
CAS 1265295-56-4 appears in our catalog under these names: Selexipag Metabolite-d6 (MRE-269-d6, ACT-333679-d6), MRE-269-d6. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg, 5 mg.
2-[4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid (CAS 1265295-56-4) is a chemical compound with the molecular formula C25H29N3O3 and a molecular weight of 425.6 g/mol. IUPAC name: 2-[4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid. InChIKey: OJQMKCBWYCWFPU-WFGJKAKNSA-N.
| Molecular formula | C25H29N3O3 |
|---|---|
| Molecular weight | 425.6 g/mol |
| IUPAC name | 2-[4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid |
| InChIKey | OJQMKCBWYCWFPU-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])N(CCCCOCC(=O)O)C1=CN=C(C(=N1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Metabolite-D6, Selexipag Impurity 2 D6