CAS 126543-43-9 appears in our catalog under these names: (R)-2-Acetamido-3-((2,2-dichlorovinyl)thio)propanoic acid, 98% mix TBC as stabilizer, N-Acetyl-S-(2,2-dichloroethenyl)-L-cysteine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
(2R)-2-acetamido-3-(2,2-dichloroethenylsulfanyl)propanoic acid (CAS 126543-43-9) is a chemical compound with the molecular formula C7H9Cl2NO3S and a molecular weight of 258.12 g/mol. IUPAC name: (2R)-2-acetamido-3-(2,2-dichloroethenylsulfanyl)propanoic acid. InChIKey: VDYGORWCAPEHPX-YFKPBYRVSA-N.
| Molecular formula | C7H9Cl2NO3S |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(2,2-dichloroethenylsulfanyl)propanoic acid |
| InChIKey | VDYGORWCAPEHPX-YFKPBYRVSA-N |
| SMILES | CC(=O)N[C@@H](CSC=C(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)