Products 2031258-45-2
CAS 2031258-45-2 is the registry number for 3-tert-Butyl-4-chloro-1,2-oxazole-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-tert-butyl-4-chloro-1,2-oxazole-5-sulfonyl chloride (CAS 2031258-45-2) is a chemical compound with the molecular formula C7H9Cl2NO3S and a molecular weight of 258.12 g/mol. IUPAC name: 3-tert-butyl-4-chloro-1,2-oxazole-5-sulfonyl chloride. InChIKey: HRXDNHGIWZADAH-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2NO3S |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 3-tert-butyl-4-chloro-1,2-oxazole-5-sulfonyl chloride |
| InChIKey | HRXDNHGIWZADAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)