CAS 1795787-09-5 appears in our catalog under these names: N-Acetyl-S-(2,2-dichloroethenyl)-L-cysteine-13C,d3, >95% (HPLC), N–Acetyl–S–(2,2–dichloroethenyl)–L–cysteine–13C,d3. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg, 50mg.
(2R)-3-(2,2-dichloroethenylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 1795787-09-5) is a chemical compound with the molecular formula C7H9Cl2NO3S and a molecular weight of 262.13 g/mol. IUPAC name: (2R)-3-(2,2-dichloroethenylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: VDYGORWCAPEHPX-RIVLQAMOSA-N.
| Molecular formula | C7H9Cl2NO3S |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | (2R)-3-(2,2-dichloroethenylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | VDYGORWCAPEHPX-RIVLQAMOSA-N |
| SMILES | [2H]C([2H])([2H])[13C](=O)N[C@@H](CSC=C(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)