CAS 12656-98-3 appears in our catalog under these names: Pheniramine N-Oxide, Pheniramine Aminoxide. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 1g, 100mg, 500mg, 250mg.
N,N-dimethyl-3-phenyl-3-pyridin-2-ylpropan-1-amine oxide (CAS 12656-98-3) is a chemical compound with the molecular formula C16H20N2O and a molecular weight of 256.34 g/mol. IUPAC name: N,N-dimethyl-3-phenyl-3-pyridin-2-ylpropan-1-amine oxide. InChIKey: OBBDJQMNZLQVAZ-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | N,N-dimethyl-3-phenyl-3-pyridin-2-ylpropan-1-amine oxide |
| InChIKey | OBBDJQMNZLQVAZ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC(C1=CC=CC=C1)C2=CC=CC=N2)[O-] |
Computed by PubChem (NCBI)