CAS 203793-55-9 is the registry number for L-Leucine alpha-naphthylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-amino-4-methyl-N-naphthalen-1-ylpentanamide (CAS 203793-55-9) is a chemical compound with the molecular formula C16H20N2O and a molecular weight of 256.34 g/mol. IUPAC name: (2S)-2-amino-4-methyl-N-naphthalen-1-ylpentanamide. InChIKey: VLGDNYIGYOVDNV-AWEZNQCLSA-N.
| Molecular formula | C16H20N2O |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | (2S)-2-amino-4-methyl-N-naphthalen-1-ylpentanamide |
| InChIKey | VLGDNYIGYOVDNV-AWEZNQCLSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC1=CC=CC2=CC=CC=C21)N |
Computed by PubChem (NCBI)