CAS 849021-31-4 appears in our catalog under these names: 1-(4-tert-Butylphenyl)-2-pyrimidin-4-yl ethanol, 1-(4-tert-Butylphenyl)-2-pyrimidin-4-yl ethanol, 95%, 1-(4-tert-Butylphenyl)-2-pyrimidin-4-yl ethanol, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
1-(4-tert-butylphenyl)-2-pyrimidin-4-ylethanol (CAS 849021-31-4) is a chemical compound with the molecular formula C16H20N2O and a molecular weight of 256.34 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-pyrimidin-4-ylethanol. InChIKey: PENPEXKNMMNVKA-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-pyrimidin-4-ylethanol |
| InChIKey | PENPEXKNMMNVKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(CC2=NC=NC=C2)O |
Computed by PubChem (NCBI)