CAS 126587-86-8 is the registry number for Formoterol Impurity 28. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[5-(oxiran-2-yl)-2-phenylmethoxyphenyl]formamide (CAS 126587-86-8) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: N-[5-(oxiran-2-yl)-2-phenylmethoxyphenyl]formamide. InChIKey: FGQPWFQIHSYHLV-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | N-[5-(oxiran-2-yl)-2-phenylmethoxyphenyl]formamide |
| InChIKey | FGQPWFQIHSYHLV-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=CC(=C(C=C2)OCC3=CC=CC=C3)NC=O |
Computed by PubChem (NCBI)