CAS 893737-86-5 is the registry number for Methyl 3'-(acetylamino)[1,1'-biphenyl]-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-(3-acetamidophenyl)benzoate (CAS 893737-86-5) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: methyl 4-(3-acetamidophenyl)benzoate. InChIKey: LNTLITKYZUNHBV-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | methyl 4-(3-acetamidophenyl)benzoate |
| InChIKey | LNTLITKYZUNHBV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)