CAS 1375068-89-5 is the registry number for {3-[3-(Methylcarbamoyl)phenyl]phenyl}acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[3-[3-(methylcarbamoyl)phenyl]phenyl]acetic acid (CAS 1375068-89-5) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[3-[3-(methylcarbamoyl)phenyl]phenyl]acetic acid. InChIKey: AQHSGRCMHPPOHN-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-[3-[3-(methylcarbamoyl)phenyl]phenyl]acetic acid |
| InChIKey | AQHSGRCMHPPOHN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC(=C1)C2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)