Products 1375068-89-5

CAS 1375068-89-5 is the registry number for {3-[3-(Methylcarbamoyl)phenyl]phenyl}acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[3-[3-(methylcarbamoyl)phenyl]phenyl]acetic acid (CAS 1375068-89-5) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[3-[3-(methylcarbamoyl)phenyl]phenyl]acetic acid. InChIKey: AQHSGRCMHPPOHN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15NO3
Molecular weight269.29 g/mol
IUPAC name2-[3-[3-(methylcarbamoyl)phenyl]phenyl]acetic acid
InChIKeyAQHSGRCMHPPOHN-UHFFFAOYSA-N
SMILESCNC(=O)C1=CC=CC(=C1)C2=CC=CC(=C2)CC(=O)O

Computed by PubChem (NCBI)