CAS 1266322-58-0 appears in our catalog under these names: 7–Bromoquinolin–3–amine, 7-Bromoquinolin-3-amine 98%, 7-Bromoquinolin-3-amine, 98%, 98%, 7-Bromoquinolin-3-amine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
7-bromoquinolin-3-amine (CAS 1266322-58-0) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 7-bromoquinolin-3-amine. InChIKey: CCHYPYCCQBLGLJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 7-bromoquinolin-3-amine |
| InChIKey | CCHYPYCCQBLGLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)N)Br |
Computed by PubChem (NCBI)