Products 1266685-37-3
CAS 1266685-37-3 appears in our catalog under these names: 3-Amino-5-bromo-1-methyl-2,3-dihydro-1H-indol-2-one hydrochloride, 3-amino-5-bromo-1-methyl-2,3-dihydro-1H-indol-2-one hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 1g.
3-amino-5-bromo-1-methyl-3H-indol-2-one;hydrochloride (CAS 1266685-37-3) is a chemical compound with the molecular formula C9H10BrClN2O and a molecular weight of 277.54 g/mol. IUPAC name: 3-amino-5-bromo-1-methyl-3H-indol-2-one;hydrochloride. InChIKey: YUQWALAEWKUUGU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN2O |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | 3-amino-5-bromo-1-methyl-3H-indol-2-one;hydrochloride |
| InChIKey | YUQWALAEWKUUGU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C(C1=O)N.Cl |
Computed by PubChem (NCBI)