Products 1266778-55-5
CAS 1266778-55-5 is the registry number for Boc-L-Photo-Proline. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 1g.
(5S)-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,6-triazaspiro[2.4]hept-1-ene-5-carboxylic acid (CAS 1266778-55-5) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: (5S)-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,6-triazaspiro[2.4]hept-1-ene-5-carboxylic acid. InChIKey: QHKAXDABRVVZAV-LURJTMIESA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (5S)-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,2,6-triazaspiro[2.4]hept-1-ene-5-carboxylic acid |
| InChIKey | QHKAXDABRVVZAV-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C[C@H]1C(=O)O)N=N2 |
Computed by PubChem (NCBI)