Products 1267616-28-3
CAS 1267616-28-3 appears in our catalog under these names: 1-(3-Methoxybenzyl)cyclopropanecarboxylic acid, 97%, 1-[(3-Methoxyphenyl)methyl]cyclopropane-1-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[(3-methoxyphenyl)methyl]cyclopropane-1-carboxylic acid (CAS 1267616-28-3) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 1-[(3-methoxyphenyl)methyl]cyclopropane-1-carboxylic acid. InChIKey: KAPCBQAWEBIVEE-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-[(3-methoxyphenyl)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | KAPCBQAWEBIVEE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CC2(CC2)C(=O)O |
Computed by PubChem (NCBI)