Products 1267642-46-5
CAS 1267642-46-5 is the registry number for 1-(4-(2,4-Dimethylbenzoyl)piperidin-1-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone (CAS 1267642-46-5) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: 1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone. InChIKey: YJNZWZOHLSIDGH-UHFFFAOYSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone |
| InChIKey | YJNZWZOHLSIDGH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C2CCN(CC2)C(=O)C)C |
Computed by PubChem (NCBI)