CAS 1267704-35-7 appears in our catalog under these names: 2-(2-(tert-Butyl)-4-methyloxazol-5-yl)acetic acid, 98%, 2-(2-tert-Butyl-4-methyl-1,3-oxazol-5-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 50mg, 0,5g.
2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid (CAS 1267704-35-7) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid. InChIKey: RWNMSMUWOYFMPW-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid |
| InChIKey | RWNMSMUWOYFMPW-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)C(C)(C)C)CC(=O)O |
Computed by PubChem (NCBI)