Products 1268086-96-9
CAS 1268086-96-9 is the registry number for Ethyl (1R,5R,6R)-7-acetyl-5-(pentan-3-yloxy)-7-azabicyclo(4.1.0)hept-3-ene-3-carboxylate, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
Ethyl (1R,5R,6R)-7-acetyl-5-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 1268086-96-9) is a chemical compound with the molecular formula C16H25NO4 and a molecular weight of 295.37 g/mol. IUPAC name: ethyl (1R,5R,6R)-7-acetyl-5-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: JNJVGCIZOROHDS-BOEXNKMNSA-N.
| Molecular formula | C16H25NO4 |
|---|---|
| Molecular weight | 295.37 g/mol |
| IUPAC name | ethyl (1R,5R,6R)-7-acetyl-5-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | JNJVGCIZOROHDS-BOEXNKMNSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]2[C@H]1N2C(=O)C)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Oseltamivir impurity N1