CAS 168034-31-9 appears in our catalog under these names: Boc–D–Threoninol(Bzl), Boc-D-Thr(Bzl)-ol. Offered by: GLPBio, Iris Biotech. Available pack sizes: 1g, 5g, 25g.
Tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxybutan-2-yl]carbamate (CAS 168034-31-9) is a chemical compound with the molecular formula C16H25NO4 and a molecular weight of 295.37 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxybutan-2-yl]carbamate. InChIKey: RXDBGDZAKNELGW-JSGCOSHPSA-N.
| Molecular formula | C16H25NO4 |
|---|---|
| Molecular weight | 295.37 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxybutan-2-yl]carbamate |
| InChIKey | RXDBGDZAKNELGW-JSGCOSHPSA-N |
| SMILES | C[C@@H]([C@H](CO)NC(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)