Products 1363210-32-5

CAS 1363210-32-5 is the registry number for 8-tert-Butyl 2-methyl8-azaspiro[4.5]dec-1-ene-2,8-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]dec-3-ene-3,8-dicarboxylate (CAS 1363210-32-5) is a chemical compound with the molecular formula C16H25NO4 and a molecular weight of 295.37 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]dec-3-ene-3,8-dicarboxylate. InChIKey: GIHYLCNWUSJPST-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25NO4
Molecular weight295.37 g/mol
IUPAC name8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]dec-3-ene-3,8-dicarboxylate
InChIKeyGIHYLCNWUSJPST-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCC(=C2)C(=O)OC)CC1

Computed by PubChem (NCBI)