CAS 1268334-97-9 appears in our catalog under these names: 5-(3,5-Dimethyl-4-isoxazolyl)-2-thiophenesulfonyl chloride, 95%, 5-(3,5-Dimethylisoxazol-4-yl)thiophene-2-sulfonyl chloride 97%, 5-(3,5-Dimethylisoxazol-4-yl)thiophene-2-sulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophene-2-sulfonyl chloride (CAS 1268334-97-9) is a chemical compound with the molecular formula C9H8ClNO3S2 and a molecular weight of 277.8 g/mol. IUPAC name: 5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophene-2-sulfonyl chloride. InChIKey: HNBKVHRJMPOBKY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3S2 |
|---|---|
| Molecular weight | 277.8 g/mol |
| IUPAC name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)thiophene-2-sulfonyl chloride |
| InChIKey | HNBKVHRJMPOBKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)