CAS 1283341-02-5 is the registry number for 2-Methyl-5-(3-methyl-5-isoxazolyl)-3-thiophenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonyl chloride (CAS 1283341-02-5) is a chemical compound with the molecular formula C9H8ClNO3S2 and a molecular weight of 277.8 g/mol. IUPAC name: 2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonyl chloride. InChIKey: RKMYNUROVBYJJM-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3S2 |
|---|---|
| Molecular weight | 277.8 g/mol |
| IUPAC name | 2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonyl chloride |
| InChIKey | RKMYNUROVBYJJM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=CC(=C(S2)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)