CAS 443955-61-1 appears in our catalog under these names: 4-Oxo-2,3,4,5-tetrahydro-1,5-benzothiazepine-7-sulfonyl chloride, 95%, 4-Oxo-2,3,4,5-tetrahydro-1,5-benzothiazepine-7-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonyl chloride (CAS 443955-61-1) is a chemical compound with the molecular formula C9H8ClNO3S2 and a molecular weight of 277.8 g/mol. IUPAC name: 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonyl chloride. InChIKey: OGMMNAJRZGGJAT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3S2 |
|---|---|
| Molecular weight | 277.8 g/mol |
| IUPAC name | 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonyl chloride |
| InChIKey | OGMMNAJRZGGJAT-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(C=C(C=C2)S(=O)(=O)Cl)NC1=O |
Computed by PubChem (NCBI)