Products 1268520-63-3
CAS 1268520-63-3 is the registry number for 7-(tert-Butoxycarbonyl)-1-oxa-7-azaspiro(4.4)nonane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-[(2-methylpropan-2-yl)oxycarbonyl]-1-oxa-7-azaspiro[4.4]nonane-2-carboxylic acid (CAS 1268520-63-3) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-1-oxa-7-azaspiro[4.4]nonane-2-carboxylic acid. InChIKey: MSDHAJLDASVPDN-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-1-oxa-7-azaspiro[4.4]nonane-2-carboxylic acid |
| InChIKey | MSDHAJLDASVPDN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCC(O2)C(=O)O |
Computed by PubChem (NCBI)