Products 126874-42-8
CAS 126874-42-8 is the registry number for (2S-cis)-3-(Bromomethyl)-2-methyl-2-(4-methyl-3-pentenyl)oxirane. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
(2S,3S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane (CAS 126874-42-8) is a chemical compound with the molecular formula C10H17BrO and a molecular weight of 233.14 g/mol. IUPAC name: (2S,3S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane. InChIKey: YBLCNHAYWVYVPC-ZJUUUORDSA-N.
| Molecular formula | C10H17BrO |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | (2S,3S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane |
| InChIKey | YBLCNHAYWVYVPC-ZJUUUORDSA-N |
| SMILES | CC(=CCC[C@]1([C@H](O1)CBr)C)C |
Computed by PubChem (NCBI)