Products 23957-97-3
CAS 23957-97-3 is the registry number for (1S,3r,4r,6r)-4-bromo-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3R,4R,6R)-4-bromo-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol (CAS 23957-97-3) is a chemical compound with the molecular formula C10H17BrO and a molecular weight of 233.14 g/mol. IUPAC name: (1S,3R,4R,6R)-4-bromo-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol. InChIKey: ORGWXZPLJJBSHU-IBCQBUCCSA-N.
| Molecular formula | C10H17BrO |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | (1S,3R,4R,6R)-4-bromo-3,7,7-trimethylbicyclo[4.1.0]heptan-3-ol |
| InChIKey | ORGWXZPLJJBSHU-IBCQBUCCSA-N |
| SMILES | C[C@]1(C[C@H]2[C@H](C2(C)C)C[C@H]1Br)O |
Computed by PubChem (NCBI)