CAS 2065-77-2 is the registry number for 2-Bromo-3,3,5,5-tetramethylcyclohexanone, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-3,3,5,5-tetramethylcyclohexan-1-one (CAS 2065-77-2) is a chemical compound with the molecular formula C10H17BrO and a molecular weight of 233.14 g/mol. IUPAC name: 2-bromo-3,3,5,5-tetramethylcyclohexan-1-one. InChIKey: SSUUZZPYKJHKEE-UHFFFAOYSA-N.
| Molecular formula | C10H17BrO |
|---|---|
| Molecular weight | 233.14 g/mol |
| IUPAC name | 2-bromo-3,3,5,5-tetramethylcyclohexan-1-one |
| InChIKey | SSUUZZPYKJHKEE-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(C1)(C)C)Br)C |
Computed by PubChem (NCBI)