CAS 1268957-08-9 appears in our catalog under these names: 3-Amino-6-methoxy-1,3-dihydro-2h-indol-2-one hydrochloride, 95%, 3-Amino-6-methoxy-1,3-dihydro-2H-indol-2-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride (CAS 1268957-08-9) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride. InChIKey: GGYQJXWGRFYOMD-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 3-amino-6-methoxy-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | GGYQJXWGRFYOMD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(C(=O)N2)N.Cl |
Computed by PubChem (NCBI)