CAS 1268991-01-0 appears in our catalog under these names: 3-(3-Aminophenyl)-n,n-dimethylpropanamide dihydrochloride, 95%, 3-(3-Aminophenyl)-N,N-dimethylpropanamide dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(3-aminophenyl)-N,N-dimethylpropanamide;dihydrochloride (CAS 1268991-01-0) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: 3-(3-aminophenyl)-N,N-dimethylpropanamide;dihydrochloride. InChIKey: QTTMADZFXZPJAV-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | 3-(3-aminophenyl)-N,N-dimethylpropanamide;dihydrochloride |
| InChIKey | QTTMADZFXZPJAV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CCC1=CC(=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)