Products 1269039-30-6

CAS 1269039-30-6 is the registry number for N2-Methyl-n2-phenyl-1,2-propanediamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-N-methyl-2-N-phenylpropane-1,2-diamine;hydrochloride (CAS 1269039-30-6) is a chemical compound with the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. IUPAC name: 2-N-methyl-2-N-phenylpropane-1,2-diamine;hydrochloride. InChIKey: KTZZOPDXDWXQFU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17ClN2
Molecular weight200.71 g/mol
IUPAC name2-N-methyl-2-N-phenylpropane-1,2-diamine;hydrochloride
InChIKeyKTZZOPDXDWXQFU-UHFFFAOYSA-N
SMILESCC(CN)N(C)C1=CC=CC=C1.Cl

Computed by PubChem (NCBI)