CAS 306937-27-9 appears in our catalog under these names: 1-[3-(tert-Butyl)phenyl]hydrazine hydrochloride, 95%, 1-[3-(tert-Butyl)phenyl]hydrazine hydrochloride, Tech , (3-(tert-Butyl)phenyl)hydrazine hydrochloride 97%, 1-[3-(tert-Butyl)phenyl]hydrazine HCl, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3-tert-butylphenyl)hydrazine;hydrochloride (CAS 306937-27-9) is a chemical compound with the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. IUPAC name: (3-tert-butylphenyl)hydrazine;hydrochloride. InChIKey: XKLKKAKHNGXDPA-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2 |
|---|---|
| Molecular weight | 200.71 g/mol |
| IUPAC name | (3-tert-butylphenyl)hydrazine;hydrochloride |
| InChIKey | XKLKKAKHNGXDPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)NN.Cl |
Computed by PubChem (NCBI)