CAS 207850-67-7 is the registry number for 2,2-Dimethyl-1-(pyridin-4-yl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2,2-dimethyl-1-pyridin-4-ylpropan-1-amine;hydrochloride (CAS 207850-67-7) is a chemical compound with the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. IUPAC name: 2,2-dimethyl-1-pyridin-4-ylpropan-1-amine;hydrochloride. InChIKey: CTKNVORNKUYTBN-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2 |
|---|---|
| Molecular weight | 200.71 g/mol |
| IUPAC name | 2,2-dimethyl-1-pyridin-4-ylpropan-1-amine;hydrochloride |
| InChIKey | CTKNVORNKUYTBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=NC=C1)N.Cl |
Computed by PubChem (NCBI)