CAS 1269052-55-2 is the registry number for [(2,5-Dimethylphenyl)(3-pyridinyl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(2,5-dimethylphenyl)-pyridin-3-ylmethanamine;dihydrochloride (CAS 1269052-55-2) is a chemical compound with the molecular formula C14H18Cl2N2 and a molecular weight of 285.2 g/mol. IUPAC name: (2,5-dimethylphenyl)-pyridin-3-ylmethanamine;dihydrochloride. InChIKey: FYJKMRLPEXAEPS-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2 |
|---|---|
| Molecular weight | 285.2 g/mol |
| IUPAC name | (2,5-dimethylphenyl)-pyridin-3-ylmethanamine;dihydrochloride |
| InChIKey | FYJKMRLPEXAEPS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(C2=CN=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)