CAS 60410-99-3 appears in our catalog under these names: 2,2'-Dimethyl-[1,1'-biphenyl]-4,4'-diamine dihydrochloride, 95+%, 4,4’–Diamino–2,2’–dimethylbiphenyl Dihydrochloride. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 5g.
4-(4-amino-2-methylphenyl)-3-methylaniline;dihydrochloride (CAS 60410-99-3) is a chemical compound with the molecular formula C14H18Cl2N2 and a molecular weight of 285.2 g/mol. IUPAC name: 4-(4-amino-2-methylphenyl)-3-methylaniline;dihydrochloride. InChIKey: UGBRWPHXDCDHIM-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2 |
|---|---|
| Molecular weight | 285.2 g/mol |
| IUPAC name | 4-(4-amino-2-methylphenyl)-3-methylaniline;dihydrochloride |
| InChIKey | UGBRWPHXDCDHIM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C2=C(C=C(C=C2)N)C.Cl.Cl |
Computed by PubChem (NCBI)